![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| BCC 101 - Fundamentals of Biochemistry.pdf | 2021-06-16 10:25 | 108K | |
| BCC 105 - Practical I.pdf | 2021-06-16 10:25 | 107K | |
| BCC 201 - Clinical Biochemistry.pdf | 2021-06-16 10:25 | 108K | |
| BCC 206 - Practical II.pdf | 2021-06-16 10:25 | 107K | |
| BCO 103 T - Analytical Biochemistry-T.pdf | 2021-06-16 10:25 | 108K | |
| MIC 103 - Microbial Taxonomy and Systematics.pdf | 2021-06-16 10:25 | 109K | |
| MIC 104 - Biostatistics.pdf | 2021-06-16 10:25 | 107K | |
| MIC 201 - Techniques and Instrumentation in Microbiology.pdf | 2021-06-16 10:25 | 111K | |
| MIC 202 - Industrial Microbiology.pdf | 2021-06-16 10:25 | 108K | |
| MIC 203 - Molecular Biology.pdf | 2021-06-16 10:25 | 107K | |
| MIC 204 - Mycology.pdf | 2021-06-16 10:25 | 107K | |
| MIC 205 - Practical II.pdf | 2021-06-16 10:25 | 107K | |
| MIO 102 T - Environmental Microbiology and Bioremediation-T.pdf | 2021-06-16 10:25 | 110K | |
| MMC 103 - Microbial Taxonomy and Systematics.pdf | 2021-06-16 10:25 | 108K | |
| MMC 104 - Biostatistics.pdf | 2021-06-16 10:25 | 107K | |