![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| MBC 181 - Marine Microbiology and Ecology.pdf | 2022-01-24 15:56 | 295K | |
| MBC 182 - Concepts in Biochemistry.pdf | 2022-01-24 15:56 | 302K | |
| MBC 183 - Molecular Biology.pdf | 2022-01-24 15:56 | 298K | |
| MBC 184 - Biophysical principles and Analytical techniques.pdf | 2022-01-24 15:56 | 297K | |
| MBC 185 - Introductory Immunology.pdf | 2022-01-24 15:56 | 295K | |
| MBC 186 - Oceanography and Marine Bio resources.pdf | 2022-01-24 15:56 | 298K | |
| MBC 187 - Cell Biology.pdf | 2022-01-24 15:56 | 295K | |
| MBC 188 - Biostatistics.pdf | 2022-01-24 15:56 | 288K | |
| MBC 281 - Bioprocess Technology.pdf | 2022-01-24 15:56 | 292K | |
| MBO 187 - IPR, Biosafety and Bioethics.pdf | 2022-01-24 15:56 | 288K | |
| MBO 188 - Bio entrepreneurship.pdf | 2022-01-24 15:56 | 291K | |
| MBO 280 - Genetic Engineering.pdf | 2022-01-24 15:56 | 290K | |
| MBO 284 - Marine Food Biotechnology.pdf | 2022-01-24 15:56 | 292K | |
| MBO 285 - Nanobiotechnology.pdf | 2022-01-24 15:56 | 293K | |